Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Cobalt(III) 2,4-pentanedionate
CAS: 21679-46-9 Molecular Formula: C15H21CoO6 Molecular Weight (g/mol): 356.26 MDL Number: MFCD00013488 InChI Key: VACIXPOMJJIDBM-UHFFFAOYSA-N Synonym: Cobalt(III) acetylacetonate IUPAC Name: 2,4,8,10,13,15-hexamethyl-1λ³,5λ³,7λ³,11λ³,12λ³,16λ³-hexaoxa-6-cobaltaspiro[5.5⁶.5⁶]hexadeca-1,4,7,10,12,15-hexaene-6,6,6-tris(ylium)-3,9,14-triide SMILES: CC1=[O][Co+3]234([O]=C(C)[CH-]1)[O]=C(C)[CH-]C(C)=[O]2.CC([CH-]C(C)=[O]3)=[O]4
| CAS | 21679-46-9 |
|---|---|
| Molecular Weight (g/mol) | 356.26 |
| MDL Number | MFCD00013488 |
| SMILES | CC1=[O][Co+3]234([O]=C(C)[CH-]1)[O]=C(C)[CH-]C(C)=[O]2.CC([CH-]C(C)=[O]3)=[O]4 |
| Synonym | Cobalt(III) acetylacetonate |
| IUPAC Name | 2,4,8,10,13,15-hexamethyl-1λ³,5λ³,7λ³,11λ³,12λ³,16λ³-hexaoxa-6-cobaltaspiro[5.5⁶.5⁶]hexadeca-1,4,7,10,12,15-hexaene-6,6,6-tris(ylium)-3,9,14-triide |
| InChI Key | VACIXPOMJJIDBM-UHFFFAOYSA-N |
| Molecular Formula | C15H21CoO6 |
Methylcyclohexane, 99%, for spectroscopy
CAS: 108-87-2 Molecular Formula: C7H14 Molecular Weight (g/mol): 98.19 MDL Number: MFCD00001497 InChI Key: UAEPNZWRGJTJPN-UHFFFAOYSA-N Synonym: cyclohexane, methyl,hexahydrotoluene,cyclohexylmethane,toluene hexahydride,hexahydroxytoluene,sextone b,toluene, hexahydro,metylocykloheksan,methyl cyclohexane,methylcyclohexan PubChem CID: 7962 IUPAC Name: methylcyclohexane SMILES: CC1CCCCC1
| PubChem CID | 7962 |
|---|---|
| CAS | 108-87-2 |
| Molecular Weight (g/mol) | 98.19 |
| MDL Number | MFCD00001497 |
| SMILES | CC1CCCCC1 |
| Synonym | cyclohexane, methyl,hexahydrotoluene,cyclohexylmethane,toluene hexahydride,hexahydroxytoluene,sextone b,toluene, hexahydro,metylocykloheksan,methyl cyclohexane,methylcyclohexan |
| IUPAC Name | methylcyclohexane |
| InChI Key | UAEPNZWRGJTJPN-UHFFFAOYSA-N |
| Molecular Formula | C7H14 |
Succinic acid disodium salt, for biochemistry, anhydrous
CAS: 150-90-3 Molecular Formula: C4H4Na2O4 Molecular Weight (g/mol): 162.052 InChI Key: ZDQYSKICYIVCPN-UHFFFAOYSA-L Synonym: disodium succinate,sodium succinate,disodium butanedioate,butanedioic acid, disodium salt,soduxin,succinic acid disodium salt,jantaran sodny czech,unii-v8zgc8isr3,succinic acid, disodium salt,fema no. 3277 PubChem CID: 9020 ChEBI: CHEBI:63675 IUPAC Name: disodium;butanedioate SMILES: C(CC(=O)[O-])C(=O)[O-].[Na+].[Na+]
| PubChem CID | 9020 |
|---|---|
| CAS | 150-90-3 |
| Molecular Weight (g/mol) | 162.052 |
| ChEBI | CHEBI:63675 |
| SMILES | C(CC(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| Synonym | disodium succinate,sodium succinate,disodium butanedioate,butanedioic acid, disodium salt,soduxin,succinic acid disodium salt,jantaran sodny czech,unii-v8zgc8isr3,succinic acid, disodium salt,fema no. 3277 |
| IUPAC Name | disodium;butanedioate |
| InChI Key | ZDQYSKICYIVCPN-UHFFFAOYSA-L |
| Molecular Formula | C4H4Na2O4 |
2,2-Dibromo-4'-fluoroacetophenone, 98%
CAS: 7542-64-5 Molecular Formula: C8H5Br2FO Molecular Weight (g/mol): 295.933 MDL Number: MFCD03791309 InChI Key: XFFGHBAVJPOWDG-UHFFFAOYSA-N Synonym: 2,2-dibromo-1-4-fluorophenyl ethanone,alpha,alpha-dibromo-4-fluoroacetophenone,2,2-dibromo-4'-fluoroacetophenone,4'-fluoro-alpha,alpha-dibromoacetophenone,2,2-dibromo-1-4-fluorophenyl ethan-1-one,2,2-bis bromanyl-1-4-fluorophenyl ethanone PubChem CID: 2783255 IUPAC Name: 2,2-dibromo-1-(4-fluorophenyl)ethanone SMILES: C1=CC(=CC=C1C(=O)C(Br)Br)F
| PubChem CID | 2783255 |
|---|---|
| CAS | 7542-64-5 |
| Molecular Weight (g/mol) | 295.933 |
| MDL Number | MFCD03791309 |
| SMILES | C1=CC(=CC=C1C(=O)C(Br)Br)F |
| Synonym | 2,2-dibromo-1-4-fluorophenyl ethanone,alpha,alpha-dibromo-4-fluoroacetophenone,2,2-dibromo-4'-fluoroacetophenone,4'-fluoro-alpha,alpha-dibromoacetophenone,2,2-dibromo-1-4-fluorophenyl ethan-1-one,2,2-bis bromanyl-1-4-fluorophenyl ethanone |
| IUPAC Name | 2,2-dibromo-1-(4-fluorophenyl)ethanone |
| InChI Key | XFFGHBAVJPOWDG-UHFFFAOYSA-N |
| Molecular Formula | C8H5Br2FO |
2-Bromopyridine, 99%
CAS: 109-04-6 Molecular Formula: C5H4BrN Molecular Weight (g/mol): 158 MDL Number: MFCD00006219 InChI Key: IMRWILPUOVGIMU-UHFFFAOYSA-N Synonym: o-bromopyridine,pyridine, 2-bromo,2-bromo-pyridine,2-pyridyl bromide,alpha-bromopyridine,beta-bromopyridine,bromopyridine,2-bromopyridin,2-bromo pyridine,unii-7z7mlc4vd8 PubChem CID: 7973 ChEBI: CHEBI:51574 IUPAC Name: 2-bromopyridine SMILES: C1=CC=NC(=C1)Br
| PubChem CID | 7973 |
|---|---|
| CAS | 109-04-6 |
| Molecular Weight (g/mol) | 158 |
| ChEBI | CHEBI:51574 |
| MDL Number | MFCD00006219 |
| SMILES | C1=CC=NC(=C1)Br |
| Synonym | o-bromopyridine,pyridine, 2-bromo,2-bromo-pyridine,2-pyridyl bromide,alpha-bromopyridine,beta-bromopyridine,bromopyridine,2-bromopyridin,2-bromo pyridine,unii-7z7mlc4vd8 |
| IUPAC Name | 2-bromopyridine |
| InChI Key | IMRWILPUOVGIMU-UHFFFAOYSA-N |
| Molecular Formula | C5H4BrN |
1-Indanone, 99+%
CAS: 83-33-0 Molecular Formula: C9H8O Molecular Weight (g/mol): 132.16 InChI Key: QNXSIUBBGPHDDE-UHFFFAOYSA-N Synonym: 1-indanone,indan-1-one,2,3-dihydro-1h-inden-1-one,indanone,alpha-indanone,alpha-hydrindone,1h-inden-1-one, 2,3-dihydro,1-indone,hydrindone,.alpha.-indanone PubChem CID: 6735 ChEBI: CHEBI:17404 IUPAC Name: 2,3-dihydroinden-1-one SMILES: C1CC(=O)C2=CC=CC=C21
| PubChem CID | 6735 |
|---|---|
| CAS | 83-33-0 |
| Molecular Weight (g/mol) | 132.16 |
| ChEBI | CHEBI:17404 |
| SMILES | C1CC(=O)C2=CC=CC=C21 |
| Synonym | 1-indanone,indan-1-one,2,3-dihydro-1h-inden-1-one,indanone,alpha-indanone,alpha-hydrindone,1h-inden-1-one, 2,3-dihydro,1-indone,hydrindone,.alpha.-indanone |
| IUPAC Name | 2,3-dihydroinden-1-one |
| InChI Key | QNXSIUBBGPHDDE-UHFFFAOYSA-N |
| Molecular Formula | C9H8O |
Tripropylamine, 98%
CAS: 102-69-2 Molecular Formula: C9H21N Molecular Weight (g/mol): 143.27 MDL Number: MFCD00009363 InChI Key: YFTHZRPMJXBUME-UHFFFAOYSA-N Synonym: tripropylamine,tri-n-propylamine,n,n-dipropyl-1-propanamine,1-propanamine, n,n-dipropyl,propyldi-n-propylamine,tripropylammonium,tripropyl amine,npr3,n,n-dipropyl-1-propylamine,tripropylamin PubChem CID: 7616 ChEBI: CHEBI:38880 IUPAC Name: N,N-dipropylpropan-1-amine SMILES: CCCN(CCC)CCC
| PubChem CID | 7616 |
|---|---|
| CAS | 102-69-2 |
| Molecular Weight (g/mol) | 143.27 |
| ChEBI | CHEBI:38880 |
| MDL Number | MFCD00009363 |
| SMILES | CCCN(CCC)CCC |
| Synonym | tripropylamine,tri-n-propylamine,n,n-dipropyl-1-propanamine,1-propanamine, n,n-dipropyl,propyldi-n-propylamine,tripropylammonium,tripropyl amine,npr3,n,n-dipropyl-1-propylamine,tripropylamin |
| IUPAC Name | N,N-dipropylpropan-1-amine |
| InChI Key | YFTHZRPMJXBUME-UHFFFAOYSA-N |
| Molecular Formula | C9H21N |
Ethylenediamine dihydrochloride, 98%
CAS: 333-18-6 Molecular Formula: C2H10Cl2N2 Molecular Weight (g/mol): 133.02 MDL Number: MFCD00012524 InChI Key: OHHBFEVZJLBKEH-UHFFFAOYSA-N Synonym: ethylenediamine dihydrochloride,chlor-ethamine,ethylenediammonium chloride,ethylenediammonium dichloride,ethane-1,2-diamine dihydrochloride,dimethylenediamine dihydrochloride,1,2-diaminoethane dihydrochloride,1,2-ethanediamine, dihydrochloride,ethylenediamine 2hcl,dimethylenediamine diydrochloride PubChem CID: 9521 ChEBI: CHEBI:53626 IUPAC Name: ethane-1,2-diamine;dihydrochloride SMILES: [H+].[H+].[Cl-].[Cl-].NCCN
| PubChem CID | 9521 |
|---|---|
| CAS | 333-18-6 |
| Molecular Weight (g/mol) | 133.02 |
| ChEBI | CHEBI:53626 |
| MDL Number | MFCD00012524 |
| SMILES | [H+].[H+].[Cl-].[Cl-].NCCN |
| Synonym | ethylenediamine dihydrochloride,chlor-ethamine,ethylenediammonium chloride,ethylenediammonium dichloride,ethane-1,2-diamine dihydrochloride,dimethylenediamine dihydrochloride,1,2-diaminoethane dihydrochloride,1,2-ethanediamine, dihydrochloride,ethylenediamine 2hcl,dimethylenediamine diydrochloride |
| IUPAC Name | ethane-1,2-diamine;dihydrochloride |
| InChI Key | OHHBFEVZJLBKEH-UHFFFAOYSA-N |
| Molecular Formula | C2H10Cl2N2 |
Butyl 4-hydroxybenzoate, 99+%
CAS: 94-26-8 Molecular Formula: C11H14O3 Molecular Weight (g/mol): 194.23 MDL Number: MFCD00016478 InChI Key: QFOHBWFCKVYLES-UHFFFAOYSA-N Synonym: butylparaben,butyl paraben,butyl p-hydroxybenzoate,nipabutyl,butoben,butyl chemosept,butyl parasept,butyl tegosept,butyl butex,tegosept butyl PubChem CID: 7184 IUPAC Name: butyl 4-hydroxybenzoate SMILES: CCCCOC(=O)C1=CC=C(C=C1)O
| PubChem CID | 7184 |
|---|---|
| CAS | 94-26-8 |
| Molecular Weight (g/mol) | 194.23 |
| MDL Number | MFCD00016478 |
| SMILES | CCCCOC(=O)C1=CC=C(C=C1)O |
| Synonym | butylparaben,butyl paraben,butyl p-hydroxybenzoate,nipabutyl,butoben,butyl chemosept,butyl parasept,butyl tegosept,butyl butex,tegosept butyl |
| IUPAC Name | butyl 4-hydroxybenzoate |
| InChI Key | QFOHBWFCKVYLES-UHFFFAOYSA-N |
| Molecular Formula | C11H14O3 |
Di-tert-butyl dicarbonate, 97+%
CAS: 24424-99-5 Molecular Formula: C10H18O5 Molecular Weight (g/mol): 218.249 MDL Number: MFCD00008805 InChI Key: DYHSDKLCOJIUFX-UHFFFAOYSA-N Synonym: di-tert-butyl dicarbonate,boc anhydride,boc-anhydride,di-t-butyl dicarbonate,di-tert-butyl pyrocarbonate,bis tert-butoxycarbonyl oxide,di-tert-butyldicarbonate,boc2o,di-t-butyl pyrocarbonate,di tert-butyl carbonate PubChem CID: 90495 ChEBI: CHEBI:48500 IUPAC Name: tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate SMILES: CC(C)(C)OC(=O)OC(=O)OC(C)(C)C
| PubChem CID | 90495 |
|---|---|
| CAS | 24424-99-5 |
| Molecular Weight (g/mol) | 218.249 |
| ChEBI | CHEBI:48500 |
| MDL Number | MFCD00008805 |
| SMILES | CC(C)(C)OC(=O)OC(=O)OC(C)(C)C |
| Synonym | di-tert-butyl dicarbonate,boc anhydride,boc-anhydride,di-t-butyl dicarbonate,di-tert-butyl pyrocarbonate,bis tert-butoxycarbonyl oxide,di-tert-butyldicarbonate,boc2o,di-t-butyl pyrocarbonate,di tert-butyl carbonate |
| IUPAC Name | tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
| InChI Key | DYHSDKLCOJIUFX-UHFFFAOYSA-N |
| Molecular Formula | C10H18O5 |
Oxalacetic acid, 98+%
CAS: 328-42-7 Molecular Formula: C4H4O5 Molecular Weight (g/mol): 132.071 MDL Number: MFCD00002592 InChI Key: KHPXUQMNIQBQEV-UHFFFAOYSA-N Synonym: oxalacetic acid,oxaloacetic acid,2-oxosuccinic acid,oxaloacetate,ketosuccinic acid,oxosuccinic acid,2-ketosuccinic acid,butanedioic acid, oxo,oxobutanedioic acid,oxalacetate PubChem CID: 970 ChEBI: CHEBI:30744 IUPAC Name: 2-oxobutanedioic acid SMILES: C(C(=O)C(=O)O)C(=O)O
| PubChem CID | 970 |
|---|---|
| CAS | 328-42-7 |
| Molecular Weight (g/mol) | 132.071 |
| ChEBI | CHEBI:30744 |
| MDL Number | MFCD00002592 |
| SMILES | C(C(=O)C(=O)O)C(=O)O |
| Synonym | oxalacetic acid,oxaloacetic acid,2-oxosuccinic acid,oxaloacetate,ketosuccinic acid,oxosuccinic acid,2-ketosuccinic acid,butanedioic acid, oxo,oxobutanedioic acid,oxalacetate |
| IUPAC Name | 2-oxobutanedioic acid |
| InChI Key | KHPXUQMNIQBQEV-UHFFFAOYSA-N |
| Molecular Formula | C4H4O5 |
3-Butyn-2-ol, 97%
CAS: 2028-63-9 Molecular Formula: C4H6O Molecular Weight (g/mol): 70.09 MDL Number: MFCD00004541 InChI Key: GKPOMITUDGXOSB-UHFFFAOYNA-N Synonym: 3-butyn-2-ol,3-butyne-2-ol,3-hydroxy-1-butyne,1-butyn-3-ol,1-methylpropargyl alcohol,methylethynylcarbinol,1-ethynylethanol,1-methyl-2-propynyl alcohol,alpha-methylpropargyl alcohol,dl-3-butyn-2-ol PubChem CID: 16239 IUPAC Name: but-3-yn-2-ol SMILES: CC(O)C#C
| PubChem CID | 16239 |
|---|---|
| CAS | 2028-63-9 |
| Molecular Weight (g/mol) | 70.09 |
| MDL Number | MFCD00004541 |
| SMILES | CC(O)C#C |
| Synonym | 3-butyn-2-ol,3-butyne-2-ol,3-hydroxy-1-butyne,1-butyn-3-ol,1-methylpropargyl alcohol,methylethynylcarbinol,1-ethynylethanol,1-methyl-2-propynyl alcohol,alpha-methylpropargyl alcohol,dl-3-butyn-2-ol |
| IUPAC Name | but-3-yn-2-ol |
| InChI Key | GKPOMITUDGXOSB-UHFFFAOYNA-N |
| Molecular Formula | C4H6O |
1,2,3,4-Butanetetracarboxylic acid, 99+%
CAS: 1703-58-8 Molecular Formula: C8H10O8 Molecular Weight (g/mol): 234.16 MDL Number: MFCD00002722 InChI Key: GGAUUQHSCNMCAU-UHFFFAOYSA-N Synonym: 1,2,3,4-butanetetracarboxylic acid,butanetetracarboxylic acid,dsstox_cid_4670,dsstox_rid_77494,dsstox_gsid_24670,1,2,3,4-butanetetracarboxylic,meso-1,2,3,4-butanetetracarboxylic acid,acmc-20abw3,ksc176c1b,ggauuqhscnmcau-uhfffaoysa PubChem CID: 15560 IUPAC Name: butane-1,2,3,4-tetracarboxylic acid SMILES: C(C(C(CC(=O)O)C(=O)O)C(=O)O)C(=O)O
| PubChem CID | 15560 |
|---|---|
| CAS | 1703-58-8 |
| Molecular Weight (g/mol) | 234.16 |
| MDL Number | MFCD00002722 |
| SMILES | C(C(C(CC(=O)O)C(=O)O)C(=O)O)C(=O)O |
| Synonym | 1,2,3,4-butanetetracarboxylic acid,butanetetracarboxylic acid,dsstox_cid_4670,dsstox_rid_77494,dsstox_gsid_24670,1,2,3,4-butanetetracarboxylic,meso-1,2,3,4-butanetetracarboxylic acid,acmc-20abw3,ksc176c1b,ggauuqhscnmcau-uhfffaoysa |
| IUPAC Name | butane-1,2,3,4-tetracarboxylic acid |
| InChI Key | GGAUUQHSCNMCAU-UHFFFAOYSA-N |
| Molecular Formula | C8H10O8 |
O-(6-Chloro-1H-benzotriazol-1-yl)-N,N,N',N'-tetramethyluronium hexafluorophosphate, 98+%
CAS: 330645-87-9 Molecular Formula: C11H15ClF6N5OP Molecular Weight (g/mol): 413.689 MDL Number: MFCD04973268 InChI Key: ZHHGTMQHUWDEJF-UHFFFAOYSA-N Synonym: hctu,o-6-chlorobenzotriazol-1-yl-n,n,n',n'-tetramethyluronium hexafluorophosphate,2-6-chloro-1h-benzo d 1,2,3 triazol-1-yl-1,1,3,3-tetramethyluronium hexafluorophosphate v,1-bis-dimethylamino-methylene-5-chloro-3-oxy-1h-benzotriazol-1-ium hexafluorophosphate,2-6-chloro-1h-benzotriazole-1-yl-1,1,3,3-tetramethylaminium hexafluorophosphate,o-1h-6-chlorobenzotriazol-1-yl-1,1,3,3-tetramethyluronium hexafluorophosphate,o-6-chloro-1-hydrocibenzotriazol-1-yl-1,1,3,3-tetramethyluronium hexafluorophosphate,2-6-chloro-1h-benzo d 1,2,3 triazol-1-yl-1,1,3,3-tetramethylisouronium hexafluorophosphate v,pubchem12740,acmc-20aj2u PubChem CID: 42624899 IUPAC Name: [(6-chlorobenzotriazol-1-yl)oxy-(dimethylamino)methylidene]-dimethylazanium;hexafluorophosphate SMILES: CN(C)C(=[N+](C)C)ON1C2=C(C=CC(=C2)Cl)N=N1.F[P-](F)(F)(F)(F)F
| PubChem CID | 42624899 |
|---|---|
| CAS | 330645-87-9 |
| Molecular Weight (g/mol) | 413.689 |
| MDL Number | MFCD04973268 |
| SMILES | CN(C)C(=[N+](C)C)ON1C2=C(C=CC(=C2)Cl)N=N1.F[P-](F)(F)(F)(F)F |
| Synonym | hctu,o-6-chlorobenzotriazol-1-yl-n,n,n',n'-tetramethyluronium hexafluorophosphate,2-6-chloro-1h-benzo d 1,2,3 triazol-1-yl-1,1,3,3-tetramethyluronium hexafluorophosphate v,1-bis-dimethylamino-methylene-5-chloro-3-oxy-1h-benzotriazol-1-ium hexafluorophosphate,2-6-chloro-1h-benzotriazole-1-yl-1,1,3,3-tetramethylaminium hexafluorophosphate,o-1h-6-chlorobenzotriazol-1-yl-1,1,3,3-tetramethyluronium hexafluorophosphate,o-6-chloro-1-hydrocibenzotriazol-1-yl-1,1,3,3-tetramethyluronium hexafluorophosphate,2-6-chloro-1h-benzo d 1,2,3 triazol-1-yl-1,1,3,3-tetramethylisouronium hexafluorophosphate v,pubchem12740,acmc-20aj2u |
| IUPAC Name | [(6-chlorobenzotriazol-1-yl)oxy-(dimethylamino)methylidene]-dimethylazanium;hexafluorophosphate |
| InChI Key | ZHHGTMQHUWDEJF-UHFFFAOYSA-N |
| Molecular Formula | C11H15ClF6N5OP |
Guanidine nitrate, 98%, Thermo Scientific Chemicals
CAS: 506-93-4 Molecular Formula: CH6N4O3 Molecular Weight (g/mol): 122.084 MDL Number: MFCD00013028 InChI Key: CNUNWZZSUJPAHX-UHFFFAOYSA-N Synonym: guanidine nitrate,guanidinium nitrate,guanidine; nitric acid,guanidine, mononitrate,guanidine, nitrate,guanidine mononitrate,guanidine nitrate 1:1,guanidinenitrate,pubchem21372,acmc-209kpa PubChem CID: 10481 IUPAC Name: guanidine;nitric acid SMILES: C(=N)(N)N.[N+](=O)(O)[O-]
| PubChem CID | 10481 |
|---|---|
| CAS | 506-93-4 |
| Molecular Weight (g/mol) | 122.084 |
| MDL Number | MFCD00013028 |
| SMILES | C(=N)(N)N.[N+](=O)(O)[O-] |
| Synonym | guanidine nitrate,guanidinium nitrate,guanidine; nitric acid,guanidine, mononitrate,guanidine, nitrate,guanidine mononitrate,guanidine nitrate 1:1,guanidinenitrate,pubchem21372,acmc-209kpa |
| IUPAC Name | guanidine;nitric acid |
| InChI Key | CNUNWZZSUJPAHX-UHFFFAOYSA-N |
| Molecular Formula | CH6N4O3 |